CAS 1186405-20-8
:3-Methyl-3H-imidazo[4,5-b]pyridine-6-carboxaldehyde oxime
Description:
3-Methyl-3H-imidazo[4,5-b]pyridine-6-carboxaldehyde oxime is a chemical compound characterized by its unique imidazole and pyridine ring structure, which contributes to its potential biological activity. This compound features a carboxaldehyde functional group and an oxime group, which can influence its reactivity and solubility. Typically, compounds of this nature are of interest in medicinal chemistry due to their potential as pharmacological agents. The presence of the methyl group at the 3-position of the imidazole ring may affect the compound's electronic properties and steric hindrance, potentially impacting its interaction with biological targets. Additionally, the oxime functional group can participate in various chemical reactions, including condensation and rearrangement, making it versatile in synthetic applications. The compound's specific properties, such as melting point, boiling point, and solubility, would need to be determined experimentally, as they can vary based on purity and environmental conditions. Overall, 3-Methyl-3H-imidazo[4,5-b]pyridine-6-carboxaldehyde oxime represents a class of compounds with significant potential for further research and application in various fields, including pharmaceuticals and agrochemicals.
Formula:C8H8N4O
InChI:InChI=1S/C8H8N4O/c1-12-5-10-7-2-6(4-11-13)3-9-8(7)12/h2-5,13H,1H3
InChI key:InChIKey=OMVHYSROYRLNAZ-UHFFFAOYSA-N
SMILES:CN1C=2C(=CC(C=NO)=CN2)N=C1
Synonyms:- 3-Methyl-3H-imidazo[4,5-b]pyridine-6-carboxaldehyde oxime
- 3H-Imidazo[4,5-b]pyridine-6-carboxaldehyde, 3-methyl-, oxime
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.