CAS 1186405-24-2

Methyl 3-[2-chloro-3-(dimethoxymethyl)-4-pyridinyl]-2-propenoate

Description:

Methyl 3-[2-chloro-3-(dimethoxymethyl)-4-pyridinyl]-2-propenoate is a chemical compound characterized by its complex structure, which includes a pyridine ring and a propenoate moiety. The presence of a chlorine atom and dimethoxymethyl groups contributes to its unique reactivity and potential applications in organic synthesis and medicinal chemistry. This compound is likely to exhibit polar characteristics due to the electronegative chlorine and oxygen atoms, influencing its solubility in various solvents. Additionally, the propenoate functional group suggests that it may participate in Michael addition reactions or polymerization processes. The compound's molecular structure indicates potential biological activity, making it of interest in pharmaceutical research. However, specific safety and handling guidelines should be followed, as with any chemical substance, due to the potential for toxicity or reactivity. Overall, Methyl 3-[2-chloro-3-(dimethoxymethyl)-4-pyridinyl]-2-propenoate represents a versatile compound with implications in both synthetic and medicinal chemistry.

Formula: C₁₂H₁₄ClNO₄

InChI: InChI=1S/C12H14ClNO4/c1-16-9(15)5-4-8-6-7-14-11(13)10(8)12(17-2)18-3/h4-7,12H,1-3H3

InChI key: InChIKey=CCTCWUJAEGGFRO-UHFFFAOYSA-N

SMILES: C(OC)(OC)C=1C(C=CC(OC)=O)=CC=NC1Cl

Synonyms:

• 2-Propenoic acid, 3-[2-chloro-3-(dimethoxymethyl)-4-pyridinyl]-, methyl ester
• Methyl 3-[2-chloro-3-(dimethoxymethyl)-4-pyridinyl]-2-propenoate