CAS 118642-72-1
:2-BENZYL-4,4,4-TRIFLUORO-3-OXOBUTYRIC ACID ETHYL ESTER
Description:
2-Benzyl-4,4,4-trifluoro-3-oxobutyric acid ethyl ester is an organic compound characterized by its unique structure, which includes a trifluoromethyl group and an ester functional group. This compound features a benzyl group, contributing to its aromatic properties, and a keto group, which enhances its reactivity. The presence of trifluoromethyl groups typically imparts increased lipophilicity and can influence the compound's biological activity. As an ethyl ester, it is likely to exhibit moderate volatility and solubility in organic solvents, making it useful in various chemical applications, including synthesis and as an intermediate in pharmaceutical development. The trifluoromethyl group can also enhance the compound's stability and resistance to metabolic degradation. Overall, 2-benzyl-4,4,4-trifluoro-3-oxobutyric acid ethyl ester is a compound of interest in medicinal chemistry and materials science due to its distinctive chemical properties and potential applications.
Formula:C13H13F3O3
InChI:InChI=1/C13H13F3O3/c1-2-19-12(18)10(11(17)13(14,15)16)8-9-6-4-3-5-7-9/h3-7,10H,2,8H2,1H3
SMILES:CCOC(=O)C(Cc1ccccc1)C(=O)C(F)(F)F
Synonyms:- Benzenepropanoic Acid, Α-(2,2,2-Trifluoroacetyl)-, Ethyl Ester
- Ethyl 2-benzyl-4,4,4-trifluoro-3-oxobutanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.