CymitQuimica logo

CAS 118647-00-0

:

N-benzyl-2-(cyclohex-1-en-1-yl)ethanamine

Description:
N-benzyl-2-(cyclohex-1-en-1-yl)ethanamine is an organic compound characterized by its amine functional group and a unique structure that includes a benzyl group and a cyclohexene moiety. This compound features a two-carbon ethyl chain connecting the amine to the cyclohexene, which contributes to its potential reactivity and interaction with biological systems. The presence of the cyclohexene ring introduces unsaturation, which can affect the compound's stability and reactivity, particularly in electrophilic addition reactions. N-benzyl-2-(cyclohex-1-en-1-yl)ethanamine may exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, influencing its solubility and interaction with other molecules. Additionally, the benzyl group can enhance lipophilicity, potentially affecting its pharmacokinetic properties if considered for medicinal applications. Overall, the structural features of this compound suggest it may have interesting chemical behavior and potential applications in organic synthesis or medicinal chemistry.
Formula:C15H21N
InChI:InChI=1/C15H21N/c1-3-7-14(8-4-1)11-12-16-13-15-9-5-2-6-10-15/h2,5-7,9-10,16H,1,3-4,8,11-13H2
SMILES:C1CC=C(CC1)CCNCc1ccccc1
Synonyms:
  • benzenemethanamine, N-[2-(1-cyclohexen-1-yl)ethyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.