
CAS 1186477-77-9
:5,7-Dichloro-2,3-dimethyl-1H-indole
Description:
5,7-Dichloro-2,3-dimethyl-1H-indole is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of two chlorine atoms at the 5 and 7 positions, along with two methyl groups at the 2 and 3 positions, contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit a range of colors depending on its purity and form. It is likely to be sparingly soluble in water but more soluble in organic solvents due to its hydrophobic nature. The chlorine substituents can enhance the compound's reactivity, making it of interest in various chemical syntheses and potential applications in pharmaceuticals or agrochemicals. Additionally, the presence of multiple functional groups may influence its biological activity, making it a candidate for further research in medicinal chemistry. Safety data should be consulted for handling and storage, as halogenated compounds can pose health risks.
Formula:C10H9Cl2N
InChI:InChI=1S/C10H9Cl2N/c1-5-6(2)13-10-8(5)3-7(11)4-9(10)12/h3-4,13H,1-2H3
InChI key:InChIKey=CGXVCZZRNKINPP-UHFFFAOYSA-N
SMILES:ClC1=C2C(C(C)=C(C)N2)=CC(Cl)=C1
Synonyms:- 5,7-Dichloro-2,3-dimethyl-1H-indole
- 2,3-Dimethyl-5,7-dichloro-1H-indole
- 1H-Indole, 5,7-dichloro-2,3-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.