CAS 1186663-24-0
:Benzenesulfonic acid, 4-fluoro-, hydrate (1:1)
Description:
Benzenesulfonic acid, 4-fluoro-, hydrate (1:1) is an organic compound characterized by the presence of a sulfonic acid group (-SO3H) attached to a benzene ring that also features a fluorine substituent at the para position. This compound is typically encountered as a hydrate, indicating that it contains water molecules in its crystalline structure. The sulfonic acid group imparts strong acidity, making it a useful reagent in various chemical reactions, including sulfonation and as a catalyst in organic synthesis. The presence of the fluorine atom can influence the compound's reactivity and solubility, often enhancing its electrophilic character. Additionally, the hydrate form suggests that it may exhibit specific solubility and stability characteristics in aqueous environments. Overall, this compound is of interest in both industrial applications and research, particularly in the development of pharmaceuticals and agrochemicals, where sulfonic acids play a crucial role in modifying the properties of active ingredients.
Formula:C6H5FO3S·H2O
InChI:InChI=1S/C6H5FO3S.H2O/c7-5-1-3-6(4-2-5)11(8,9)10;/h1-4H,(H,8,9,10);1H2
InChI key:InChIKey=BZVCYJOVKZUHKY-UHFFFAOYSA-N
SMILES:S(=O)(=O)(O)C1=CC=C(F)C=C1.O
Synonyms:- Benzenesulfonic acid, 4-fluoro-, hydrate (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
