
CAS 1186663-30-8
:Piperazine, 1-(4-bromophenyl)-4-methyl-, hydrobromide (1:1)
Description:
Piperazine, 1-(4-bromophenyl)-4-methyl-, hydrobromide (1:1) is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The presence of a 4-bromophenyl group and a methyl group at specific positions on the piperazine ring contributes to its unique properties. As a hydrobromide salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. This compound may exhibit biological activity, potentially acting as a pharmacological agent, and is of interest in medicinal chemistry for its potential therapeutic effects. Its molecular structure suggests it may interact with biological targets, making it relevant in drug development. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity. Overall, this compound exemplifies the diverse functionalities that can arise from modifications to the piperazine scaffold.
Formula:C11H15BrN2·BrH
InChI:InChI=1S/C11H15BrN2.BrH/c1-13-6-8-14(9-7-13)11-4-2-10(12)3-5-11;/h2-5H,6-9H2,1H3;1H
InChI key:InChIKey=JDBVRNDPKPXLKM-UHFFFAOYSA-N
SMILES:BrC1=CC=C(C=C1)N2CCN(C)CC2.Br
Synonyms:- Piperazine, 1-(4-bromophenyl)-4-methyl-, hydrobromide (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.