CAS 1186663-35-3

Thiazolo[5,4-c]pyridin-2-amine, 4,5,6,7-tetrahydro-, hydrochloride (1:1)

Description:

Thiazolo[5,4-c]pyridin-2-amine, 4,5,6,7-tetrahydro-, hydrochloride (1:1) is a chemical compound characterized by its unique bicyclic structure that incorporates both thiazole and pyridine rings. This compound typically appears as a hydrochloride salt, which enhances its solubility in water and makes it suitable for various applications in medicinal chemistry. The presence of the tetrahydro moiety indicates that the compound has undergone partial saturation, which can influence its biological activity and pharmacokinetic properties. Thiazolo-pyridine derivatives are often investigated for their potential therapeutic effects, including antimicrobial, anti-inflammatory, and anticancer activities. The specific arrangement of functional groups and the stereochemistry of the compound can significantly affect its reactivity and interaction with biological targets. As with many nitrogen-containing heterocycles, this compound may exhibit interesting electronic properties, making it a candidate for further research in drug development and material science. Safety and handling precautions should be observed, as with all chemical substances, particularly those with biological activity.

Formula: C₆H₉N₃S·ClH

InChI: InChI=1S/C6H9N3S.ClH/c7-6-9-4-1-2-8-3-5(4)10-6;/h8H,1-3H2,(H2,7,9);1H

InChI key: InChIKey=FCXFWRSXDRUNDI-UHFFFAOYSA-N

SMILES: NC1=NC2=C(S1)CNCC2.Cl

Synonyms:

• Thiazolo[5,4-c]pyridin-2-amine, 4,5,6,7-tetrahydro-, hydrochloride (1:1)

4,5,6,7-Tetrahydro-1,3-thiazolo[5,4-c]pyridin-2-ylamine, HCl

CAS: 1186663-35-3

Formula: C₆H₁₀ClN₃S

Molecular weight: 191.6817

Ref: IN-DA0099MR

4,5,6,7-Tetrahydrothiazolo[5,4-c]pyridin-2-amine hydrochloride

CAS: 1186663-35-3

Purity: 97%

Molecular weight: 191.6799927

Ref: 10-F607948