CAS 1186663-63-7
:Morpholine, 4-(4-bromophenyl)-, hydrochloride (1:1)
Description:
Morpholine, 4-(4-bromophenyl)-, hydrochloride (1:1) is a chemical compound characterized by its morpholine backbone substituted with a 4-bromophenyl group. This compound typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, which is indicative of its polar nature due to the presence of the morpholine ring and the hydrochloride salt form. The morpholine structure contributes to its basicity, while the bromophenyl group can influence its reactivity and potential biological activity. This compound may be utilized in various applications, including medicinal chemistry, where it could serve as an intermediate in the synthesis of pharmaceuticals or as a research tool in biological studies. Safety data should be consulted, as halogenated compounds can exhibit varying degrees of toxicity and environmental impact. Proper handling and storage conditions are essential to ensure safety and stability.
Formula:C10H12BrNO·ClH
InChI:InChI=1S/C10H12BrNO.ClH/c11-9-1-3-10(4-2-9)12-5-7-13-8-6-12;/h1-4H,5-8H2;1H
InChI key:InChIKey=GBGVMVYEGPLMBJ-UHFFFAOYSA-N
SMILES:BrC1=CC=C(C=C1)N2CCOCC2.Cl
Synonyms:- Morpholine, 4-(4-bromophenyl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
