CAS 1186663-65-9: 3-Methyl-4-(methylsulfonyl)benzoic acid

Description:3-Methyl-4-(methylsulfonyl)benzoic acid is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with a methyl group and a methylsulfonyl group. The presence of the methylsulfonyl group enhances its solubility in polar solvents and may influence its reactivity and biological activity. This compound typically exhibits acidic properties due to the carboxylic acid functional group, allowing it to donate protons in solution. Its molecular structure suggests potential applications in pharmaceuticals, particularly in drug design, where modifications to aromatic compounds can lead to enhanced efficacy or reduced side effects. Additionally, the compound may exhibit specific interactions with biological targets, making it of interest in medicinal chemistry. The CAS number 1186663-65-9 uniquely identifies this substance, facilitating its recognition in chemical databases and literature. Overall, 3-Methyl-4-(methylsulfonyl)benzoic acid is a versatile compound with potential applications in various fields, including organic synthesis and medicinal chemistry.

Formula:C₉H₁₀O₄S

InChI:InChI=1S/C9H10O4S/c1-6-5-7(9(10)11)3-4-8(6)14(2,12)13/h3-5H,1-2H3,(H,10,11)

InChI key:InChIKey=JVBNILACPMFONW-UHFFFAOYSA-N

SMILES:O=C(O)C1=CC=C(C(=C1)C)S(=O)(=O)C

Synonyms:
Benzoic acid, 3-methyl-4-(methylsulfonyl)-
3-Methyl-4-(methylsulfonyl)benzoic acid
3-Methyl-4-methylsulfonylbenzoic acid

Found 3 products.

Product data	Purity	Price range	Estimated delivery
3-Methyl-4-(methylsulfonyl)benzoic Acid REF: IN-DA003JPRCAS: 1186663-65-9	97%	To inquire	Mon 03 Mar 25
3-Methyl-4-(methylsulfonyl)benzoic acid REF: 3D-LXB66365CAS: 1186663-65-9	Min. 95%	To inquire	Mon 14 Apr 25
3-Methyl-4-(methylsulfonyl)benzoic acid REF: 10-F446578CAS: 1186663-65-9	95.0%	- - -	Discontinued product