CAS 118672-20-1

4-CHLOROBENZYLSULFONYLACETIC ACID

Description:

4-Chlorobenzylsulfonylacetic acid is an organic compound characterized by its sulfonyl and carboxylic acid functional groups, which contribute to its reactivity and potential applications in medicinal chemistry. The presence of the chlorobenzyl group enhances its lipophilicity, potentially influencing its biological activity and solubility in organic solvents. This compound typically appears as a solid at room temperature and may exhibit moderate stability under standard conditions. Its sulfonyl group can participate in various chemical reactions, making it a versatile intermediate in organic synthesis. Additionally, the carboxylic acid moiety can engage in hydrogen bonding, affecting its interactions with biological targets. The compound's unique structure suggests potential utility in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. However, detailed studies on its pharmacokinetics, toxicity, and specific applications would be necessary to fully understand its characteristics and potential uses in various fields, including medicinal chemistry and agrochemicals.

Formula: C₉H₉ClO₄S

InChI: InChI=1/C9H9ClO4S/c10-8-3-1-7(2-4-8)5-15(13,14)6-9(11)12/h1-4H,5-6H2,(H,11,12)

SMILES: c1cc(ccc1CS(=O)(=O)CC(=O)O)Cl

Synonyms:

• Acetic Acid, 2-[[(4-Chlorophenyl)Methyl]Sulfonyl]-

[(4-Chlorobenzyl)sulfonyl]acetic acid

CAS: 118672-20-1

Formula: C₉H₉ClO₄S

Purity: 95%

Color and Shape: Solid

Molecular weight: 248.6834

Ref: IN-DA0075QP

[(4-chlorobenzyl)sulfonyl]acetic acid

CAS: 118672-20-1

Formula: C₉H₉ClO₄S

Purity: 95%+

Molecular weight: 248.68

Ref: 10-F367714