CAS 118685-34-0

1H-Benzotriazole, 6-butyl-, sodium salt (1:1)

Description:

1H-Benzotriazole, 6-butyl-, sodium salt (1:1) is an organic compound characterized by its benzotriazole structure, which features a triazole ring fused to a benzene ring. This compound is typically used as a corrosion inhibitor and UV stabilizer in various applications, including plastics and coatings. The presence of the butyl group enhances its solubility and hydrophobic properties, making it effective in formulations requiring compatibility with organic solvents. As a sodium salt, it exhibits ionic characteristics, which can influence its solubility in water and other polar solvents. The compound is known for its ability to absorb UV light, thereby protecting materials from photodegradation. Additionally, it may exhibit antimicrobial properties, contributing to its utility in preserving the integrity of materials. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance. Overall, 1H-Benzotriazole, 6-butyl-, sodium salt is valued for its multifunctional roles in enhancing the durability and longevity of various products.

Formula: C₁₀H₁₃N₃·Na

InChI: InChI=1S/C10H13N3.Na/c1-2-3-4-8-5-6-9-10(7-8)12-13-11-9;/h5-7H,2-4H2,1H3,(H,11,12,13);

InChI key: InChIKey=JWIZJSPTACJGQQ-UHFFFAOYSA-N

SMILES: C(CCC)C=1C=C2C(=CC1)N=NN2.[Na]

Synonyms:

• 1H-Benzotriazole, 5-butyl-, sodium salt
• SA 35 (inhibitor)
• SA 35
• 1H-Benzotriazole, 6-butyl-, sodium salt (1:1)

Sodium 5-butylbenzo[d][1,2,3]triazol-1-ide

CAS: 118685-34-0

Formula: C₁₀H₁₂N₃Na

Molecular weight: 197.2121

Ref: IN-DA0096DK