CAS 118689-07-9
:2-(2,4-difluorophenyl)-3-(1H-1,2,4-triazol-1-yl)propane-1,2-diol
Description:
2-(2,4-Difluorophenyl)-3-(1H-1,2,4-triazol-1-yl)propane-1,2-diol is a chemical compound characterized by its unique structural features, which include a difluorophenyl group and a triazole moiety. This compound typically exhibits properties such as moderate solubility in polar solvents, which is influenced by the presence of hydroxyl groups in its structure. The difluorophenyl group contributes to its lipophilicity, while the triazole ring can participate in hydrogen bonding and may enhance its biological activity. The compound may also display potential as a pharmaceutical agent, given the presence of the triazole, which is often associated with antifungal and antimicrobial properties. Its molecular interactions can be further explored in the context of drug design and development. Additionally, the presence of fluorine atoms can enhance metabolic stability and influence the compound's pharmacokinetic profile. Overall, this compound's characteristics make it a subject of interest in medicinal chemistry and related fields.
Formula:C11H11F2N3O2
InChI:InChI=1/C11H11F2N3O2/c12-8-1-2-9(10(13)3-8)11(18,5-17)4-16-7-14-6-15-16/h1-3,6-7,17-18H,4-5H2
SMILES:c1cc(c(cc1F)F)C(Cn1cncn1)(CO)O
Synonyms:- 2-(2,4-Difluorophenyl)-3-(1H-1,2,4-triazol-1-yl)-1,2-propanediol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Fluconazole Diol (2-(2,4-Difluorophenyl)-3-(1H-1,2,4-triazol-1-yl)propane-1,2-diol)
CAS:Heterocyclic compounds with nitrogen hetero-atom(s) only, aromatic or modified aromatic, nesoiFormula:C11H11F2N3O2Color and Shape:White SolidMolecular weight:255.081932-(2,4-Difluorophenyl)-3-(1H-1,2,4-triazol-1-yl)propane-1,2-diol
CAS:Formula:C11H11F2N3O2Purity:98%Color and Shape:SolidMolecular weight:255.2207Fluconazole EP Impurity F
CAS:Formula:C11H11F2N3O2Color and Shape:White To Off-White SolidMolecular weight:255.232-(2,4-Difluorophenyl)-3-(1H-1,2,4-Triazol-1-yl)-1,2-Propanediol
CAS:2-(2,4-Difluorophenyl)-3-(1H-1,2,4-Triazol-1-yl)-1,2-PropanediolPurity:98%Molecular weight:255.22g/mol2-(2,4-Difluorophenyl)-3-(1H-1,2,4-triazol-1-yl)propane-1,2-diol
CAS:Purity:98%+(LC-MS);RGMolecular weight:255.22500612-(2,4-Difluorophenyl)-3-(1H-1,2,4-triazol-1-yl)-1,2-propanediol
CAS:Controlled ProductImpurity Fluconazole EP Impurity F
Stability Hygroscopic
Applications 2-(2,4-Difluorophenyl)-3-(1H-1,2,4-triazol-1-yl)-1,2-propanediol (Fluconazole EP Impurity F) is a diol impurity of the antifungal agent Fluconazole (F421000).
References Dongre, V.G. et al.: J. Pharmac. Biomed. Anal., 42, 334 (2006):Formula:C11H11F2N3O2Color and Shape:Light YellowMolecular weight:255.22








