CAS 118696-65-4
:(3aR,4R,6aS)-4-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one
Description:
The chemical substance with the name "(3aR,4R,6aS)-4-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one" and CAS number "118696-65-4" is a complex organic compound characterized by its multi-ring structure and specific stereochemistry. It features a cyclopentafuran core, which is a fused cyclic structure that contributes to its unique chemical properties. The presence of a hydroxyl group indicates potential for hydrogen bonding, influencing its solubility and reactivity. The dioxolane moiety suggests that the compound may exhibit interesting interactions with other molecules, particularly in biological systems. Additionally, the heptyl chain enhances its hydrophobic characteristics, which may affect its partitioning in biological membranes. Overall, this compound's structural features suggest potential applications in pharmaceuticals or as a biochemical probe, although specific biological activities would require further investigation. Its stereochemistry is crucial for determining its interactions and effects in various chemical environments.
Formula:C19H32O5
InChI:InChI=1/C19H32O5/c1-2-3-4-5-6-8-19(22-10-11-23-19)9-7-14-15-12-18(21)24-17(15)13-16(14)20/h14-17,20H,2-13H2,1H3/t14-,15-,16?,17+/m1/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(3aR,4R,5R,6aS)-4-[3-(Ethyleneketal)decanyl]hexahydro-5-hydroxy-2H-cyclopenta[b]furan-2-one
CAS:Formula:C19H32O5Molecular weight:340.46
