CAS 1187-12-8
:2-(Diaminomethylene)propanedinitrile
Description:
2-(Diaminomethylene)propanedinitrile, also known by its CAS number 1187-12-8, is an organic compound characterized by its unique structure featuring two amino groups and two cyano groups attached to a propane backbone. This compound is typically a colorless to pale yellow solid at room temperature and is soluble in polar solvents due to the presence of the amino groups. It exhibits basic properties due to the amine functionalities, which can participate in hydrogen bonding and nucleophilic reactions. The cyano groups contribute to its reactivity, making it a potential precursor in the synthesis of various nitrogen-containing compounds. Additionally, 2-(Diaminomethylene)propanedinitrile may have applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. However, handling this compound requires caution due to its potential toxicity and the need for appropriate safety measures to mitigate exposure risks. Overall, its distinctive chemical properties make it a compound of interest in both academic and industrial chemistry contexts.
Formula:C4H4N4
InChI:InChI=1S/C4H4N4/c5-1-3(2-6)4(7)8/h7-8H2
InChI key:InChIKey=KBGWULLXFVTZCA-UHFFFAOYSA-N
SMILES:C(=C(N)N)(C#N)C#N
Synonyms:- Propanedinitrile, 2-(diaminomethylene)-
- Malononitrile, (diaminomethylene)-
- Propanedinitrile, (diaminomethylene)-
- 2-(Diaminomethylene)propanedinitrile
- 1,1-Diamino-2,2-dicyanoethylene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.