CAS 1187-27-5

METHYL 2-CYANO-3-(DIMETHYLAMINO)ACRYLATE

Description:

Methyl 2-cyano-3-(dimethylamino)acrylate, with the CAS number 1187-27-5, is an organic compound characterized by its acrylate structure, which includes a cyano group and a dimethylamino substituent. This compound typically appears as a colorless to pale yellow liquid and is known for its reactivity, particularly in polymerization processes. It is soluble in organic solvents, making it useful in various chemical applications, including as a monomer in the synthesis of polymers and copolymers. The presence of the cyano group contributes to its ability to participate in nucleophilic reactions, while the dimethylamino group can influence the compound's basicity and reactivity. Methyl 2-cyano-3-(dimethylamino)acrylate is often utilized in the production of coatings, adhesives, and other materials due to its ability to form cross-linked structures. As with many acrylates, it may pose health risks, necessitating appropriate safety measures during handling and use.

Formula: C₇H₁₀N₂O₂

InChI: InChI=1/C7H10N2O2/c1-9(2)5-6(4-8)7(10)11-3/h5H,1-3H3

SMILES: CN(C)C=C(C#N)C(=O)OC

Synonyms:

• Methyl 2-Cyano-3-(Dimethylamino)Prop-2-Enoate

Methyl 2-cyano-3-(dimethylamino)acrylate

CAS: 1187-27-5

Formula: C₇H₁₀N₂O₂

Color and Shape: Solid

Molecular weight: 154.1665

Ref: IN-DA0080Z5