
CAS 1187-56-0
:Butanoic acid, 2-amino-4-(methylseleno-75Se)-, (2S)-
Description:
Butanoic acid, 2-amino-4-(methylseleno-75Se)-, (2S)-, also known by its CAS number 1187-56-0, is an organoselenium compound characterized by the presence of a butanoic acid backbone with an amino group and a methylseleno group. This compound features a chiral center, denoted by the (2S) configuration, indicating its specific stereochemistry. The methylseleno group incorporates selenium-75, a radioactive isotope of selenium, which can be utilized in various applications, including radiolabeling in biochemical studies. Butanoic acid itself is a four-carbon straight-chain carboxylic acid, contributing to the compound's acidic properties. The presence of the amino group introduces basic characteristics, allowing for potential interactions in biological systems. Overall, this compound exhibits unique chemical properties due to the combination of its functional groups and the incorporation of selenium, making it of interest in both synthetic and medicinal chemistry contexts. Its stability, solubility, and reactivity can vary based on environmental conditions and the presence of other chemical species.
Formula:C5H11NO2Se
InChI:InChI=1S/C5H11NO2Se/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)/t4-/m0/s1/i9-4
InChI key:InChIKey=RJFAYQIBOAGBLC-ZEMBQCNESA-N
SMILES:[C@@H](C(O)=O)(CC[75Se]C)N
Synonyms:- L-Selenomethionine-75Se
- Butyric acid, 2-amino-4-(methylselenyl-75Se)-, L-
- Butanoic acid, 2-amino-4-(methylseleno-75Se)-, (S)-
- [75Se]-L-Selenomethionine
- Butanoic acid, 2-amino-4-(methylseleno-75Se)-, (2S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Selenomethionine Se 75
CAS:Selenomethionine Se 75, as a Radioactive Agent, can be used as a Diagnostic Aid for Pancreas Function Determination.
Formula:C5H11NO2SeColor and Shape:SolidMolecular weight:192.07
