CymitQuimica logo

CAS 1187-83-3

:

O-aminoserine

Description:
O-aminoserine, with the CAS number 1187-83-3, is an amino alcohol that serves as an important intermediate in various biochemical pathways. It is characterized by the presence of both an amino group (-NH2) and a hydroxyl group (-OH) attached to a serine backbone, which contributes to its polar nature and solubility in water. This compound plays a role in the biosynthesis of certain amino acids and is involved in metabolic processes. O-aminoserine can exist in different forms, including its zwitterionic state, where it carries both a positive and a negative charge, enhancing its reactivity and interaction with other biomolecules. Its structural features allow it to participate in hydrogen bonding, making it a key player in enzyme-substrate interactions. Additionally, O-aminoserine is of interest in pharmaceutical research due to its potential applications in drug development and as a building block for more complex molecules. Overall, its unique chemical properties make it significant in both biological and synthetic chemistry contexts.
Formula:C3H8N2O3
InChI:InChI=1/C3H8N2O3/c4-2(1-8-5)3(6)7/h2H,1,4-5H2,(H,6,7)
SMILES:C(C(C(=O)O)N)ON
Synonyms:
  • beta-Aminoxyalanine
  • Serine, O-amino-
  • O-amino-L-serine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.