
CAS 1187087-19-9
:4,4-Difluoro-3-piperidinol
Description:
4,4-Difluoro-3-piperidinol is a chemical compound characterized by its piperidine ring structure, which is a six-membered ring containing one nitrogen atom. The presence of two fluorine atoms at the 4-position of the ring significantly influences its chemical properties, including its reactivity and polarity. The hydroxyl group (-OH) at the 3-position contributes to its potential as a nucleophile and may enhance its solubility in polar solvents. This compound is of interest in medicinal chemistry due to its potential applications in drug development, particularly in the synthesis of pharmaceuticals. Its unique fluorinated structure may impart desirable biological activities or improve pharmacokinetic properties. Additionally, the presence of fluorine can enhance metabolic stability and alter lipophilicity, making it a valuable scaffold in the design of new therapeutic agents. As with many fluorinated compounds, safety and handling considerations are important due to the potential for toxicity and environmental impact. Overall, 4,4-Difluoro-3-piperidinol represents a versatile building block in organic synthesis and medicinal chemistry.
Formula:C5H9F2NO
InChI:InChI=1S/C5H9F2NO/c6-5(7)1-2-8-3-4(5)9/h4,8-9H,1-3H2
InChI key:InChIKey=WCNZGFYSIIPMMR-UHFFFAOYSA-N
SMILES:OC1C(F)(F)CCNC1
Synonyms:- 3-Piperidinol, 4,4-difluoro-
- 4,4-Difluoro-3-piperidinol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.