CAS 1187163-21-8
:(3,5-Dimethoxyphenyl)(6-methyl-2-pyridinyl)methanone
Description:
(3,5-Dimethoxyphenyl)(6-methyl-2-pyridinyl)methanone, identified by its CAS number 1187163-21-8, is a chemical compound characterized by its complex structure, which includes a phenyl group substituted with two methoxy groups and a pyridine ring with a methyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of functional groups. The methoxy groups can influence its solubility and polarity, making it more soluble in organic solvents. Additionally, the presence of the pyridine ring may impart basicity and contribute to the compound's biological activity. Such compounds are often studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The specific interactions and reactivity of this compound would depend on its environment and the presence of other reactants, making it a subject of interest in both synthetic and medicinal chemistry.
Formula:C15H15NO3
InChI:InChI=1S/C15H15NO3/c1-10-5-4-6-14(16-10)15(17)11-7-12(18-2)9-13(8-11)19-3/h4-9H,1-3H3
InChI key:InChIKey=UPYQPJGEJNVBRY-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(OC)=CC(OC)=C1)C=2N=C(C)C=CC2
Synonyms:- (3,5-Dimethoxyphenyl)(6-methyl-2-pyridinyl)methanone
- Methanone, (3,5-dimethoxyphenyl)(6-methyl-2-pyridinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.