CymitQuimica logo

CAS 1187163-24-1

:

(2,3-Dimethylphenyl)(6-methyl-2-pyridinyl)methanone

Description:
(2,3-Dimethylphenyl)(6-methyl-2-pyridinyl)methanone, identified by its CAS number 1187163-24-1, is an organic compound characterized by its complex structure, which includes a phenyl group substituted with two methyl groups and a pyridine ring with a methyl substituent. This compound features a ketone functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of both aromatic and heterocyclic components suggests that it may exhibit interesting electronic properties and could participate in various chemical reactions, such as electrophilic aromatic substitution or nucleophilic addition. Its molecular structure may also influence its solubility, boiling point, and stability under different conditions. As with many organic compounds, the specific characteristics such as melting point, boiling point, and solubility would depend on the purity and the conditions under which the compound is studied. Overall, this compound may have relevance in fields such as medicinal chemistry, materials science, or agrochemicals, depending on its biological activity and chemical behavior.
Formula:C15H15NO
InChI:InChI=1S/C15H15NO/c1-10-6-4-8-13(12(10)3)15(17)14-9-5-7-11(2)16-14/h4-9H,1-3H3
InChI key:InChIKey=CBUQHUCWOGNLJH-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(C)C(C)=CC=C1)C=2N=C(C)C=CC2
Synonyms:
  • (2,3-Dimethylphenyl)(6-methyl-2-pyridinyl)methanone
  • Methanone, (2,3-dimethylphenyl)(6-methyl-2-pyridinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.