CymitQuimica logo

CAS 1187163-29-6

:

4-(5-Methyl-2-pyridinyl)benzenamine

Description:
4-(5-Methyl-2-pyridinyl)benzenamine, identified by its CAS number 1187163-29-6, is an organic compound characterized by the presence of both a pyridine and an aniline functional group. This compound features a benzene ring substituted with an amino group and a pyridine ring that has a methyl group at the 5-position. The molecular structure suggests that it may exhibit properties typical of both aromatic amines and heterocyclic compounds, potentially influencing its reactivity and solubility. The presence of the methyl group can enhance lipophilicity, while the amino group may participate in hydrogen bonding, affecting its interactions in biological systems. Such compounds are often of interest in medicinal chemistry and materials science due to their potential applications in drug development and as intermediates in organic synthesis. Additionally, the specific arrangement of substituents can lead to unique electronic properties, making it a candidate for further study in various chemical contexts.
Formula:C12H12N2
InChI:InChI=1S/C12H12N2/c1-9-2-7-12(14-8-9)10-3-5-11(13)6-4-10/h2-8H,13H2,1H3
InChI key:InChIKey=OIYGIPFBOIQFDI-UHFFFAOYSA-N
SMILES:NC1=CC=C(C=C1)C2=CC=C(C)C=N2
Synonyms:
  • 4-(5-Methyl-2-pyridinyl)benzenamine
  • Benzenamine, 4-(5-methyl-2-pyridinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.