CAS 1187163-32-1
:Magnesium, bromo[5-(1,3-dioxan-2-yl)-2-methoxyphenyl]-
Description:
Magnesium, bromo[5-(1,3-dioxan-2-yl)-2-methoxyphenyl]- is a chemical compound characterized by its unique structure that includes a magnesium atom coordinated with a bromo-substituted aromatic ring. The presence of the 1,3-dioxane moiety suggests that the compound may exhibit properties related to solubility and reactivity, particularly in organic solvents. The methoxy group contributes to the compound's potential for engaging in various chemical reactions, such as nucleophilic substitutions or electrophilic aromatic substitutions. Additionally, the bromine atom serves as a good leaving group, which can facilitate further chemical transformations. This compound may be of interest in synthetic organic chemistry, particularly in the development of pharmaceuticals or agrochemicals, due to its potential reactivity and the functional groups present. As with many organometallic compounds, handling and storage require careful consideration of stability and reactivity, particularly in the presence of moisture or air.
Formula:C11H13BrMgO3
InChI:InChI=1S/C11H13O3.BrH.Mg/c1-12-10-5-3-9(4-6-10)11-13-7-2-8-14-11;;/h3-5,11H,2,7-8H2,1H3;1H;/q;;+1/p-1
InChI key:InChIKey=GIFDNWDFZLMOFB-UHFFFAOYSA-M
SMILES:[Mg](Br)C=1C=C(C=CC1OC)C2OCCCO2
Synonyms:- 5-(1,3-Dioxan-2-yl)-2-methoxyphenylmagnesium bromide
- Magnesium, bromo[5-(1,3-dioxan-2-yl)-2-methoxyphenyl]-
- Bromo-[5-(1,3-dioxan-2-yl)-2-methoxyphenyl]magnesium
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.