CAS 1187163-35-4
:(2-Iodophenyl)(5-methyl-2-pyridinyl)methanone
Description:
(2-Iodophenyl)(5-methyl-2-pyridinyl)methanone is an organic compound characterized by its complex structure, which includes a phenyl group substituted with iodine and a pyridine ring with a methyl group. This compound features a ketone functional group, indicating the presence of a carbonyl (C=O) moiety. The iodine atom contributes to the compound's reactivity and potential applications in various chemical reactions, including electrophilic substitutions. The presence of the pyridine ring suggests potential biological activity, as many pyridine derivatives are known for their pharmacological properties. Additionally, the methyl group on the pyridine enhances the lipophilicity of the molecule, which can influence its solubility and interaction with biological systems. Overall, this compound's unique structural features may make it of interest in medicinal chemistry and materials science, where it could serve as a precursor or intermediate in the synthesis of more complex molecules.
Formula:C13H10INO
InChI:InChI=1S/C13H10INO/c1-9-6-7-12(15-8-9)13(16)10-4-2-3-5-11(10)14/h2-8H,1H3
InChI key:InChIKey=JNKKJBOFFKCZHS-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(I)C=CC=C1)C2=CC=C(C)C=N2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.