CAS 1187163-48-9

Ethyl 5-(5-methyl-2-pyridinyl)-2-thiophenecarboxylate

Description:

Ethyl 5-(5-methyl-2-pyridinyl)-2-thiophenecarboxylate is a chemical compound characterized by its unique structure, which includes a thiophene ring and a pyridine moiety. This compound typically exhibits properties associated with both heterocyclic aromatic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of functional groups. The ethyl ester functional group contributes to its reactivity, making it a candidate for various chemical transformations. Additionally, the presence of the methyl group on the pyridine ring can influence its electronic properties and steric hindrance, potentially affecting its biological activity and interactions. This compound may be of interest in medicinal chemistry and material science due to its structural features, which could lead to applications in drug development or as a building block in organic synthesis. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact would depend on its concentration and exposure levels.

Formula: C₁₃H₁₃NO₂S

InChI: InChI=1S/C13H13NO2S/c1-3-16-13(15)12-7-6-11(17-12)10-5-4-9(2)8-14-10/h4-8H,3H2,1-2H3

InChI key: InChIKey=OHRXZMHFJWQGER-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1SC(=CC1)C2=CC=C(C)C=N2

Synonyms:

• 2-Thiophenecarboxylic acid, 5-(5-methyl-2-pyridinyl)-, ethyl ester
• Ethyl 5-(5-methyl-2-pyridinyl)-2-thiophenecarboxylate