CymitQuimica logo

CAS 1187163-51-4

:

(5-Methyl-2-pyridinyl)(3-phenoxyphenyl)methanone

Description:
(5-Methyl-2-pyridinyl)(3-phenoxyphenyl)methanone, identified by its CAS number 1187163-51-4, is an organic compound characterized by its complex structure, which includes a pyridine ring and a phenyl group. The presence of the methyl group at the 5-position of the pyridine ring contributes to its unique chemical properties, potentially influencing its reactivity and solubility. This compound features a ketone functional group, which is indicative of its ability to participate in various chemical reactions, such as nucleophilic additions. The phenoxyphenyl moiety enhances its potential for interactions with biological targets, making it of interest in medicinal chemistry. Its molecular structure suggests that it may exhibit specific pharmacological activities, although detailed studies would be necessary to elucidate its biological effects. Additionally, the compound's stability, solubility in organic solvents, and potential applications in drug development or as a chemical intermediate would depend on its specific interactions with other molecules. Overall, this compound represents a class of organic molecules with potential utility in various chemical and pharmaceutical applications.
Formula:C19H15NO2
InChI:InChI=1S/C19H15NO2/c1-14-10-11-18(20-13-14)19(21)15-6-5-9-17(12-15)22-16-7-3-2-4-8-16/h2-13H,1H3
InChI key:InChIKey=YMYNGSMJHPIGFU-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(OC2=CC=CC=C2)=CC=C1)C3=CC=C(C)C=N3
Synonyms:
  • Methanone, (5-methyl-2-pyridinyl)(3-phenoxyphenyl)-
  • (5-Methyl-2-pyridinyl)(3-phenoxyphenyl)methanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.