CAS 1187163-52-5

Ethyl 5-(4-methyl-2-pyridinyl)-2-thiophenecarboxylate

Description:

Ethyl 5-(4-methyl-2-pyridinyl)-2-thiophenecarboxylate is a chemical compound characterized by its unique structure, which includes a thiophene ring and a pyridine moiety. This compound typically exhibits properties associated with both heterocyclic aromatic compounds and esters. It is likely to be a pale yellow to light brown liquid or solid, depending on its purity and specific conditions. The presence of the ethyl ester group suggests it may have moderate solubility in organic solvents, while the thiophene and pyridine rings contribute to its potential for aromatic interactions and reactivity. This compound may also exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure allows for various functional group transformations, which can be exploited in synthetic applications. As with many organic compounds, safety precautions should be taken when handling it, including the use of appropriate personal protective equipment and adherence to safety data sheet guidelines.

Formula: C₁₃H₁₃NO₂S

InChI: InChI=1S/C13H13NO2S/c1-3-16-13(15)12-5-4-11(17-12)10-8-9(2)6-7-14-10/h4-8H,3H2,1-2H3

InChI key: InChIKey=TULXKNRRYPQZCC-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1SC(=CC1)C2=CC(C)=CC=N2

Synonyms:

• 2-Thiophenecarboxylic acid, 5-(4-methyl-2-pyridinyl)-, ethyl ester
• Ethyl 5-(4-methyl-2-pyridinyl)-2-thiophenecarboxylate