CymitQuimica logo

CAS 1187163-59-2

:

2-Thiophenecarboxylic acid, 5-(4-methyl-3-pyridinyl)-, ethyl ester

Description:
2-Thiophenecarboxylic acid, 5-(4-methyl-3-pyridinyl)-, ethyl ester is an organic compound characterized by its thiophene and pyridine moieties, which contribute to its aromatic properties and potential biological activity. The presence of the ethyl ester functional group suggests it may exhibit moderate lipophilicity, influencing its solubility and permeability in biological systems. This compound is likely to participate in various chemical reactions typical of carboxylic acids and esters, such as hydrolysis and esterification. Its structure may allow for interactions with biological targets, making it of interest in medicinal chemistry and drug development. The specific arrangement of the thiophene and pyridine rings can also affect its electronic properties, potentially leading to unique reactivity patterns. Additionally, the compound's molecular weight, boiling point, and melting point would be influenced by its functional groups and overall structure, which are important for understanding its behavior in different environments. Overall, this compound represents a class of substances that may have applications in pharmaceuticals or agrochemicals due to their diverse chemical properties.
Formula:C13H13NO2S
InChI:InChI=1S/C13H13NO2S/c1-3-16-13(15)12-5-4-11(17-12)10-8-14-7-6-9(10)2/h4-8H,3H2,1-2H3
InChI key:InChIKey=VDPRISGPCFFLCO-UHFFFAOYSA-N
SMILES:CC=1C(C=2SC(C(OCC)=O)=CC2)=CN=CC1
Synonyms:
  • 2-Thiophenecarboxylic acid, 5-(4-methyl-3-pyridinyl)-, ethyl ester
  • Ethyl 5-(4-methylpyridin-3-yl)thiophene-2-carboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.