CAS 1187163-71-8
:Ethyl 5-(6-chloro-3-pyridinyl)-2-thiophenecarboxylate
Description:
Ethyl 5-(6-chloro-3-pyridinyl)-2-thiophenecarboxylate is a chemical compound characterized by its unique structure, which includes a thiophene ring and a pyridine moiety. This compound features a carboxylate functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the chloro substituent on the pyridine ring enhances its biological activity, making it of interest in medicinal chemistry. Ethyl 5-(6-chloro-3-pyridinyl)-2-thiophenecarboxylate is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential interactions with biological targets, which could lead to pharmacological applications. Additionally, the compound may undergo various chemical reactions, such as esterification or nucleophilic substitution, due to the presence of reactive functional groups. Overall, this compound represents a valuable scaffold for further research and development in the fields of pharmaceuticals and agrochemicals.
Formula:C12H10ClNO2S
InChI:InChI=1S/C12H10ClNO2S/c1-2-16-12(15)10-5-4-9(17-10)8-3-6-11(13)14-7-8/h3-7H,2H2,1H3
InChI key:InChIKey=GCHFLLZAAGUVJY-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1SC(=CC1)C=2C=CC(Cl)=NC2
Synonyms:- 2-Thiophenecarboxylic acid, 5-(6-chloro-3-pyridinyl)-, ethyl ester
- Ethyl 5-(6-chloro-3-pyridinyl)-2-thiophenecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.