CAS 1187163-98-9

(4-Methyl-2-pyridinyl)(3,4,5-trifluorophenyl)methanone

Description:

(4-Methyl-2-pyridinyl)(3,4,5-trifluorophenyl)methanone, with the CAS number 1187163-98-9, is an organic compound characterized by its complex structure, which includes a pyridine ring and a trifluorophenyl group. The presence of the methyl group on the pyridine ring contributes to its lipophilicity, potentially influencing its solubility and reactivity. The trifluoromethyl groups on the phenyl ring enhance the compound's electron-withdrawing properties, which can affect its chemical behavior, including reactivity and stability. This compound may exhibit significant biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. Additionally, the presence of fluorine atoms can impart unique properties such as increased metabolic stability and altered pharmacokinetics. Overall, this compound's distinctive features make it a subject of interest for further study in various chemical and biological contexts.

Formula: C₁₃H₈F₃NO

InChI: InChI=1S/C13H8F3NO/c1-7-2-3-17-11(4-7)13(18)8-5-9(14)12(16)10(15)6-8/h2-6H,1H3

InChI key: InChIKey=HXEDRYJUEQUWLZ-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(F)=C(F)C(F)=C1)C2=CC(C)=CC=N2

Synonyms:

• (4-Methyl-2-pyridinyl)(3,4,5-trifluorophenyl)methanone
• Methanone, (4-methyl-2-pyridinyl)(3,4,5-trifluorophenyl)-