CAS 1187164-02-8

5′-Bromo-4-methyl-2,2′-bipyridine

Description:

5′-Bromo-4-methyl-2,2′-bipyridine is an organic compound characterized by its bipyridine structure, which consists of two pyridine rings connected by a carbon-carbon bond. The presence of a bromine atom at the 5′ position and a methyl group at the 4 position on one of the pyridine rings contributes to its unique chemical properties. This compound is typically used in coordination chemistry and as a ligand in metal complexes due to its ability to coordinate with transition metals. It exhibits moderate solubility in organic solvents and may participate in various chemical reactions, including electrophilic substitution and metal coordination. The bromine substituent can also influence the reactivity and stability of the compound, making it a valuable building block in synthetic organic chemistry. Additionally, its structural features may impart interesting electronic properties, which can be exploited in materials science and catalysis. Overall, 5′-Bromo-4-methyl-2,2′-bipyridine is a versatile compound with applications in both academic research and industrial processes.

Formula: C₁₁H₉BrN₂

InChI: InChI=1S/C11H9BrN2/c1-8-4-5-13-11(6-8)10-3-2-9(12)7-14-10/h2-7H,1H3

InChI key: InChIKey=PUUUSJLVYHNFLH-UHFFFAOYSA-N

SMILES: CC=1C=C(N=CC1)C2=CC=C(Br)C=N2

Synonyms:

• 2-(5-Bromopyridin-2-yl)-4-methylpyridine
• 5′-Bromo-4-methyl-2,2′-bipyridine
• 2,2′-Bipyridine, 5′-bromo-4-methyl-

5′-Bromo-4-methyl-[2,2′]bipyridinyl

CAS: 1187164-02-8

Formula: C₁₁H₉BrN₂

Purity: 97.0%

Molecular weight: 249.111

Ref: 10-F200911