CAS 1187164-07-3

(3,4-Dichlorophenyl)(4-methyl-2-pyridinyl)methanone

Description:

(3,4-Dichlorophenyl)(4-methyl-2-pyridinyl)methanone, identified by its CAS number 1187164-07-3, is a chemical compound characterized by its complex structure, which includes a dichlorophenyl group and a pyridinyl moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The presence of chlorine substituents on the phenyl ring can influence its reactivity and solubility, while the pyridine ring may impart basicity and enhance interactions with biological targets. Such compounds are often investigated for their pharmacological properties, including potential applications in medicinal chemistry. The molecular structure suggests that it may participate in various chemical reactions, including electrophilic substitutions and nucleophilic attacks, due to the electron-withdrawing effects of the chlorine atoms. Overall, (3,4-Dichlorophenyl)(4-methyl-2-pyridinyl)methanone represents a class of compounds that may have significant implications in drug development and other chemical applications.

Formula: C₁₃H₉Cl₂NO

InChI: InChI=1S/C13H9Cl2NO/c1-8-4-5-16-12(6-8)13(17)9-2-3-10(14)11(15)7-9/h2-7H,1H3

InChI key: InChIKey=GSZGIXKYFQPQEE-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(Cl)=C(Cl)C=C1)C2=CC(C)=CC=N2

Synonyms:

• Methanone, (3,4-dichlorophenyl)(4-methyl-2-pyridinyl)-
• (3,4-Dichlorophenyl)(4-methyl-2-pyridinyl)methanone