CymitQuimica logo

CAS 1187164-10-8

:

Ethyl 5-(3-quinolinyl)-2-thiophenecarboxylate

Description:
Ethyl 5-(3-quinolinyl)-2-thiophenecarboxylate is an organic compound characterized by its unique structure, which includes a quinoline moiety and a thiophene ring. This compound typically exhibits properties associated with both aromatic systems, such as stability and potential for π-π stacking interactions. The presence of the ethyl ester functional group suggests it may be soluble in organic solvents and could participate in various chemical reactions, including esterification and nucleophilic substitutions. The quinoline part of the molecule may impart biological activity, as quinoline derivatives are known for their pharmacological properties, including antimicrobial and antimalarial effects. Additionally, the thiophene ring can contribute to electronic properties, making this compound of interest in materials science and organic electronics. Overall, Ethyl 5-(3-quinolinyl)-2-thiophenecarboxylate is a compound with potential applications in medicinal chemistry and materials development, owing to its structural features and the reactivity of its functional groups.
Formula:C16H13NO2S
InChI:InChI=1S/C16H13NO2S/c1-2-19-16(18)15-8-7-14(20-15)12-9-11-5-3-4-6-13(11)17-10-12/h3-10H,2H2,1H3
InChI key:InChIKey=FDFJDHHJAFJRIX-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1SC(C2=CC3=C(N=C2)C=CC=C3)=CC1
Synonyms:
  • 2-Thiophenecarboxylic acid, 5-(3-quinolinyl)-, ethyl ester
  • Ethyl 5-(3-quinolinyl)-2-thiophenecarboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.