CAS 1187164-12-0

5-Bromo-6′-chloro-2,3′-bipyridine

Description:

5-Bromo-6′-chloro-2,3′-bipyridine is a heterocyclic organic compound characterized by its bipyridine structure, which consists of two pyridine rings connected by a carbon-carbon bond. The presence of bromine and chlorine substituents at specific positions on the bipyridine framework contributes to its unique chemical properties. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to its aromatic nature. It is often used in various chemical syntheses and may serve as a building block in the development of pharmaceuticals or agrochemicals. The halogen substituents can influence the compound's reactivity, making it a potential candidate for further functionalization or coordination with metal ions in coordination chemistry. Additionally, the compound's structure may impart specific electronic properties, which can be useful in applications such as organic electronics or as ligands in catalysis. Safety data should be consulted for handling and storage, as halogenated compounds can pose health and environmental risks.

Formula: C₁₀H₆BrClN₂

InChI: InChI=1S/C10H6BrClN2/c11-8-2-3-9(13-6-8)7-1-4-10(12)14-5-7/h1-6H

InChI key: InChIKey=UHVVHYCXBVCNIK-UHFFFAOYSA-N

SMILES: ClC=1C=CC(=CN1)C2=CC=C(Br)C=N2

Synonyms:

• 5-Bromo-6′-chloro-2,3′-bipyridine
• 2,3′-Bipyridine, 5-bromo-6′-chloro-

5-Bromo-6′-chloro-[2,3′]bipyridinyl

CAS: 1187164-12-0

Formula: C₁₀H₆BrClN₂

Purity: 97.0%

Molecular weight: 269.53

Ref: 10-F200940