CAS 1187164-14-2
:(2,4-Dimethoxyphenyl)(4-methyl-3-pyridinyl)methanone
Description:
(2,4-Dimethoxyphenyl)(4-methyl-3-pyridinyl)methanone, identified by its CAS number 1187164-14-2, is an organic compound characterized by its complex structure, which includes a phenyl group substituted with two methoxy groups and a pyridine ring with a methyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The presence of methoxy groups can enhance lipophilicity and influence the compound's reactivity and solubility in organic solvents. Additionally, the pyridine moiety may impart basicity and contribute to interactions with biological targets. Such compounds are often investigated for their pharmacological properties, including potential roles in medicinal chemistry. The specific characteristics, such as melting point, boiling point, and spectral data, would require experimental determination or literature reference for precise values. Overall, this compound's unique structural features suggest potential applications in drug development and other chemical research areas.
Formula:C15H15NO3
InChI:InChI=1S/C15H15NO3/c1-10-6-7-16-9-13(10)15(17)12-5-4-11(18-2)8-14(12)19-3/h4-9H,1-3H3
InChI key:InChIKey=IAYNUPHRUKWZJS-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(OC)C=C(OC)C=C1)C=2C(C)=CC=NC2
Synonyms:- (2,4-Dimethoxyphenyl)(4-methyl-3-pyridinyl)methanone
- Methanone, (2,4-dimethoxyphenyl)(4-methyl-3-pyridinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.