CAS 1187164-19-7

(4-Ethylphenyl)(3-methyl-2-pyridinyl)methanone

Description:

(4-Ethylphenyl)(3-methyl-2-pyridinyl)methanone, identified by its CAS number 1187164-19-7, is an organic compound characterized by its complex structure, which includes a ketone functional group and aromatic rings. This compound features a phenyl group substituted with an ethyl group at the para position and a pyridine ring with a methyl group at the meta position. The presence of these functional groups suggests potential applications in pharmaceuticals or as intermediates in organic synthesis. The compound is likely to exhibit moderate to high lipophilicity due to its aromatic nature, which may influence its solubility and reactivity. Additionally, the presence of the ketone group may impart specific reactivity patterns, such as nucleophilic addition or condensation reactions. Its molecular structure indicates potential for various interactions, including hydrogen bonding and π-π stacking, which could affect its physical properties, such as melting and boiling points. Overall, this compound's unique characteristics make it of interest in both academic research and industrial applications.

Formula: C₁₅H₁₅NO

InChI: InChI=1S/C15H15NO/c1-3-12-6-8-13(9-7-12)15(17)14-11(2)5-4-10-16-14/h4-10H,3H2,1-2H3

InChI key: InChIKey=JSCRGIGYRFCVGM-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(C)C=CC=N1)C2=CC=C(CC)C=C2

Synonyms:

• (4-Ethylphenyl)(3-methyl-2-pyridinyl)methanone
• Methanone, (4-ethylphenyl)(3-methyl-2-pyridinyl)-