CAS 1187164-22-2
:(3-Methoxyphenyl)(6-methyl-2-pyridinyl)methanone
Description:
(3-Methoxyphenyl)(6-methyl-2-pyridinyl)methanone, identified by its CAS number 1187164-22-2, is an organic compound characterized by its unique structural features. It consists of a methoxy-substituted phenyl group and a methyl-substituted pyridine moiety, linked through a carbonyl (ketone) functional group. This compound exhibits properties typical of ketones, including a polar carbonyl group that can participate in hydrogen bonding, influencing its solubility and reactivity. The presence of the methoxy group enhances its electron-donating characteristics, potentially affecting its reactivity in electrophilic aromatic substitution reactions. Additionally, the pyridine ring contributes to the compound's overall basicity and can participate in coordination with metal ions. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both aromatic and heterocyclic components that can interact with biological targets. Overall, (3-Methoxyphenyl)(6-methyl-2-pyridinyl)methanone is a versatile compound with interesting chemical properties and potential applications in various fields.
Formula:C14H13NO2
InChI:InChI=1S/C14H13NO2/c1-10-5-3-8-13(15-10)14(16)11-6-4-7-12(9-11)17-2/h3-9H,1-2H3
InChI key:InChIKey=LQIWJLIRWYMFTC-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(OC)=CC=C1)C=2N=C(C)C=CC2
Synonyms:- (3-Methoxyphenyl)(6-methyl-2-pyridinyl)methanone
- Methanone, (3-methoxyphenyl)(6-methyl-2-pyridinyl)-
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery