CAS 1187164-25-5
:[4-(1,1-Dimethylethyl)phenyl](6-methoxy-2-pyridinyl)methanone
Description:
The chemical substance known as [4-(1,1-Dimethylethyl)phenyl](6-methoxy-2-pyridinyl)methanone, with the CAS number 1187164-25-5, is an organic compound characterized by its complex structure, which includes a phenyl group substituted with a tert-butyl group and a pyridinyl moiety. This compound features a ketone functional group, which contributes to its reactivity and potential applications in various chemical reactions. The presence of the methoxy group enhances its solubility in organic solvents and may influence its biological activity. The tert-butyl group is known for providing steric hindrance, which can affect the compound's interactions with other molecules. Overall, this substance may exhibit interesting properties that could be explored in fields such as medicinal chemistry, agrochemicals, or materials science, depending on its specific reactivity and interactions with biological systems or other chemical entities. Further studies would be necessary to elucidate its full range of characteristics and potential applications.
Formula:C17H19NO2
InChI:InChI=1S/C17H19NO2/c1-17(2,3)13-10-8-12(9-11-13)16(19)14-6-5-7-15(18-14)20-4/h5-11H,1-4H3
InChI key:InChIKey=OVKNIURJUQNPQV-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC=C(C(C)(C)C)C=C1)C=2N=C(OC)C=CC2
Synonyms:- Methanone, [4-(1,1-dimethylethyl)phenyl](6-methoxy-2-pyridinyl)-
- [4-(1,1-Dimethylethyl)phenyl](6-methoxy-2-pyridinyl)methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.