CAS 1187164-26-6
:Bromo[4-(1,3-dioxan-2-yl)-3-fluorophenyl]magnesium
Description:
Bromo[4-(1,3-dioxan-2-yl)-3-fluorophenyl]magnesium is an organomagnesium compound, typically classified as a Grignard reagent. Grignard reagents are characterized by their highly reactive nature, particularly towards electrophiles, due to the presence of a carbon-magnesium bond. This specific compound features a bromo substituent and a fluorophenyl group, which can influence its reactivity and solubility. The presence of the 1,3-dioxane moiety suggests potential for chelation and stabilization in certain reactions. As with many Grignard reagents, it is sensitive to moisture and air, requiring an anhydrous environment for storage and use. The compound is likely to participate in nucleophilic addition reactions, making it valuable in organic synthesis for forming carbon-carbon bonds. Its unique structure may also impart specific electronic properties, affecting its reactivity profile. Overall, Bromo[4-(1,3-dioxan-2-yl)-3-fluorophenyl]magnesium is a versatile reagent in synthetic organic chemistry, particularly in the formation of complex organic molecules.
Formula:C10H10BrFMgO2
InChI:InChI=1S/C10H10FO2.BrH.Mg/c11-9-5-2-1-4-8(9)10-12-6-3-7-13-10;;/h1,4-5,10H,3,6-7H2;1H;/q;;+1/p-1
InChI key:InChIKey=PIOMIZADBDGTCJ-UHFFFAOYSA-M
SMILES:FC1=C(C=CC([Mg]Br)=C1)C2OCCCO2
Synonyms:- Magnesium, bromo[4-(1,3-dioxan-2-yl)-3-fluorophenyl]-
- Bromo[4-(1,3-dioxan-2-yl)-3-fluorophenyl]magnesium
- 4-(1,3-Dioxan-2-yl)-3-fluorophenylmagnesium bromide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.