CAS 1187164-34-6

(2,4-Dimethylphenyl)(4-methyl-3-pyridinyl)methanone

Description:

(2,4-Dimethylphenyl)(4-methyl-3-pyridinyl)methanone, identified by its CAS number 1187164-34-6, is an organic compound characterized by its complex structure, which includes a dimethyl-substituted phenyl group and a methyl-substituted pyridine moiety attached to a carbonyl group. This compound typically exhibits properties common to ketones, such as being a polar molecule due to the presence of the carbonyl functional group, which can engage in hydrogen bonding. The presence of multiple methyl groups contributes to its hydrophobic characteristics, potentially influencing its solubility in various organic solvents. The pyridine ring introduces basicity and can participate in coordination with metal ions, making it of interest in coordination chemistry. Additionally, the compound may exhibit biological activity, which could be relevant in pharmaceutical applications. Its synthesis and reactivity can be influenced by the steric and electronic effects of the substituents, making it a subject of interest in organic synthesis and medicinal chemistry.

Formula: C₁₅H₁₅NO

InChI: InChI=1S/C15H15NO/c1-10-4-5-13(12(3)8-10)15(17)14-9-16-7-6-11(14)2/h4-9H,1-3H3

InChI key: InChIKey=PJLWQEJYJHOMRE-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(C)C=C(C)C=C1)C=2C(C)=CC=NC2

Synonyms:

• Methanone, (2,4-dimethylphenyl)(4-methyl-3-pyridinyl)-
• (2,4-Dimethylphenyl)(4-methyl-3-pyridinyl)methanone