CAS 1187164-35-7

(2,4-Difluorophenyl)(6-methyl-3-pyridinyl)methanone

Description:

(2,4-Difluorophenyl)(6-methyl-3-pyridinyl)methanone, identified by its CAS number 1187164-35-7, is a chemical compound characterized by its unique structure, which includes a difluorophenyl group and a pyridinyl moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic systems, contributing to its potential reactivity and stability. The presence of fluorine atoms enhances its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. The methanone functional group indicates that it contains a carbonyl group, which can participate in various chemical reactions, such as nucleophilic addition. Additionally, the compound's molecular geometry and electronic distribution can affect its interactions with biological targets, potentially leading to applications in drug development. Overall, (2,4-Difluorophenyl)(6-methyl-3-pyridinyl)methanone represents a class of compounds that may exhibit significant pharmacological properties, warranting further investigation in medicinal chemistry.

Formula: C₁₃H₉F₂NO

InChI: InChI=1S/C13H9F2NO/c1-8-2-3-9(7-16-8)13(17)11-5-4-10(14)6-12(11)15/h2-7H,1H3

InChI key: InChIKey=UYDNQDHGDVXPPO-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(F)C=C(F)C=C1)C=2C=CC(C)=NC2

Synonyms:

• (2,4-Difluorophenyl)(6-methyl-3-pyridinyl)methanone
• Methanone, (2,4-difluorophenyl)(6-methyl-3-pyridinyl)-