CymitQuimica logo

CAS 1187164-37-9

:

(6-Methoxy-2-pyridinyl)(4-propylphenyl)methanone

Description:
(6-Methoxy-2-pyridinyl)(4-propylphenyl)methanone, identified by its CAS number 1187164-37-9, is an organic compound characterized by its complex structure, which includes a pyridine ring and a propyl-substituted phenyl group. The presence of the methoxy group on the pyridine ring enhances its electron-donating properties, potentially influencing its reactivity and solubility in various solvents. This compound may exhibit biological activity due to its structural features, making it of interest in medicinal chemistry and drug development. Its molecular framework suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the compound's stability, melting point, and solubility characteristics would depend on the specific conditions and solvents used. As with many organic compounds, proper handling and storage are essential to maintain its integrity and prevent degradation. Further studies would be necessary to fully elucidate its properties and potential applications in various fields, including pharmaceuticals and materials science.
Formula:C16H17NO2
InChI:InChI=1S/C16H17NO2/c1-3-5-12-8-10-13(11-9-12)16(18)14-6-4-7-15(17-14)19-2/h4,6-11H,3,5H2,1-2H3
InChI key:InChIKey=QTYBAEUFCGTWLO-UHFFFAOYSA-N
SMILES:C(=O)(C=1N=C(OC)C=CC1)C2=CC=C(CCC)C=C2
Synonyms:
  • (6-Methoxy-2-pyridinyl)(4-propylphenyl)methanone
  • Methanone, (6-methoxy-2-pyridinyl)(4-propylphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.