CymitQuimica logo

CAS 1187164-38-0

:

(6-Methyl-2-pyridinyl)(3-phenoxyphenyl)methanone

Description:
(6-Methyl-2-pyridinyl)(3-phenoxyphenyl)methanone, identified by its CAS number 1187164-38-0, is an organic compound characterized by its complex structure, which includes a pyridine ring and a phenyl group substituted with a phenoxy moiety. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for engaging in electrophilic substitution reactions. The presence of the methyl group on the pyridine ring can influence its electronic properties, potentially enhancing its reactivity. The phenoxy group may contribute to the compound's solubility in organic solvents and its ability to interact with biological systems, making it of interest in pharmaceutical applications. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, allowing for its identification and characterization in laboratory settings. Overall, this compound's unique structural features suggest potential utility in various chemical and medicinal contexts, warranting further investigation into its properties and applications.
Formula:C19H15NO2
InChI:InChI=1S/C19H15NO2/c1-14-7-5-12-18(20-14)19(21)15-8-6-11-17(13-15)22-16-9-3-2-4-10-16/h2-13H,1H3
InChI key:InChIKey=VQEVCYRTKABENB-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(OC2=CC=CC=C2)=CC=C1)C=3N=C(C)C=CC3
Synonyms:
  • Methanone, (6-methyl-2-pyridinyl)(3-phenoxyphenyl)-
  • (6-Methyl-2-pyridinyl)(3-phenoxyphenyl)methanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.