CymitQuimica logo

CAS 1187164-39-1

:

(4-Methyl-3-pyridinyl)(3,4,5-trifluorophenyl)methanone

Description:
(4-Methyl-3-pyridinyl)(3,4,5-trifluorophenyl)methanone, identified by its CAS number 1187164-39-1, is a chemical compound characterized by its complex structure, which includes a pyridine ring and a trifluorophenyl group. The presence of the methyl group on the pyridine ring contributes to its lipophilicity, potentially influencing its solubility and biological activity. The trifluoromethyl groups on the phenyl ring enhance the compound's electron-withdrawing properties, which can affect its reactivity and stability. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in targeting specific biological pathways. Additionally, the presence of fluorine atoms often correlates with increased metabolic stability and bioavailability in pharmaceutical compounds. Overall, the unique combination of functional groups in (4-Methyl-3-pyridinyl)(3,4,5-trifluorophenyl)methanone positions it as a potentially valuable compound in various chemical and biological research fields.
Formula:C13H8F3NO
InChI:InChI=1S/C13H8F3NO/c1-7-2-3-17-6-9(7)13(18)8-4-10(14)12(16)11(15)5-8/h2-6H,1H3
InChI key:InChIKey=XHRVTPTYCAIDEP-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(F)=C(F)C(F)=C1)C=2C(C)=CC=NC2
Synonyms:
  • (4-Methyl-3-pyridinyl)(3,4,5-trifluorophenyl)methanone
  • Methanone, (4-methyl-3-pyridinyl)(3,4,5-trifluorophenyl)-
Found 1 products.