CymitQuimica logo

CAS 1187164-40-4

:

(3-Methyl-2-pyridinyl)(4-propoxyphenyl)methanone

Description:
(3-Methyl-2-pyridinyl)(4-propoxyphenyl)methanone, identified by its CAS number 1187164-40-4, is an organic compound characterized by its unique molecular structure, which includes a pyridine ring and a phenyl group with a propoxy substituent. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential for diverse chemical reactivity. The presence of the methanone functional group suggests that it may participate in various reactions, including nucleophilic addition and condensation. Its molecular structure may impart specific biological activities, making it of interest in pharmaceutical research. Additionally, the compound's solubility and reactivity can be influenced by the substituents on the aromatic rings, which can affect its interactions in biological systems or synthetic applications. Overall, (3-Methyl-2-pyridinyl)(4-propoxyphenyl)methanone represents a class of compounds that may have significant implications in medicinal chemistry and material science.
Formula:C16H17NO2
InChI:InChI=1S/C16H17NO2/c1-3-11-19-14-8-6-13(7-9-14)16(18)15-12(2)5-4-10-17-15/h4-10H,3,11H2,1-2H3
InChI key:InChIKey=DIXQMNUHYGCDRQ-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC=C(OCCC)C=C1)C2=C(C)C=CC=N2
Synonyms:
  • Methanone, (3-methyl-2-pyridinyl)(4-propoxyphenyl)-
  • (3-Methyl-2-pyridinyl)(4-propoxyphenyl)methanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.