CAS 1187164-53-9
:[4-(Heptyloxy)phenyl](6-methyl-2-pyridinyl)methanone
Description:
The chemical substance "[4-(Heptyloxy)phenyl](6-methyl-2-pyridinyl)methanone," with the CAS number 1187164-53-9, is an organic compound characterized by its complex structure, which includes a phenyl ring substituted with a heptyloxy group and a pyridinyl moiety. This compound features a ketone functional group, which contributes to its reactivity and potential applications in various chemical processes. The heptyloxy group enhances its hydrophobic properties, potentially influencing its solubility in organic solvents and its behavior in biological systems. The presence of the pyridine ring introduces basicity and can participate in coordination chemistry, making it of interest in medicinal chemistry and material science. Additionally, the methyl group on the pyridine ring may affect the electronic properties and steric hindrance of the molecule. Overall, this compound's unique structural features suggest potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. Further studies would be necessary to explore its specific properties and applications in detail.
Formula:C20H25NO2
InChI:InChI=1S/C20H25NO2/c1-3-4-5-6-7-15-23-18-13-11-17(12-14-18)20(22)19-10-8-9-16(2)21-19/h8-14H,3-7,15H2,1-2H3
InChI key:InChIKey=ARXMWHIDSHOEKO-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC=C(OCCCCCCC)C=C1)C=2N=C(C)C=CC2
Synonyms:- Methanone, [4-(heptyloxy)phenyl](6-methyl-2-pyridinyl)-
- [4-(Heptyloxy)phenyl](6-methyl-2-pyridinyl)methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.