CymitQuimica logo

CAS 1187164-57-3

:

(6-Methoxy-2-pyridinyl)(3,4,5-trifluorophenyl)methanone

Description:
(6-Methoxy-2-pyridinyl)(3,4,5-trifluorophenyl)methanone is a chemical compound characterized by its complex structure, which includes a pyridine ring and a trifluorophenyl group. The presence of the methoxy group at the 6-position of the pyridine ring enhances its solubility and reactivity, while the trifluoromethyl groups on the phenyl ring contribute to its electronic properties, making it potentially useful in various chemical applications. This compound may exhibit significant biological activity, as many derivatives of pyridine and phenyl groups are known for their roles in pharmaceuticals and agrochemicals. Its molecular structure suggests potential interactions with biological targets, which could be explored in drug discovery. Additionally, the trifluoromethyl groups can influence the lipophilicity and metabolic stability of the compound. Overall, (6-Methoxy-2-pyridinyl)(3,4,5-trifluorophenyl)methanone represents a versatile scaffold for further chemical modifications and investigations in medicinal chemistry.
Formula:C13H8F3NO2
InChI:InChI=1S/C13H8F3NO2/c1-19-11-4-2-3-10(17-11)13(18)7-5-8(14)12(16)9(15)6-7/h2-6H,1H3
InChI key:InChIKey=RFGHTNDTWOOSQK-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(F)=C(F)C(F)=C1)C=2N=C(OC)C=CC2
Synonyms:
  • Methanone, (6-methoxy-2-pyridinyl)(3,4,5-trifluorophenyl)-
  • (6-Methoxy-2-pyridinyl)(3,4,5-trifluorophenyl)methanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.