CymitQuimica logo

CAS 1187164-59-5

:

(3,4-Dichlorophenyl)(3-methyl-2-pyridinyl)methanone

Description:
(3,4-Dichlorophenyl)(3-methyl-2-pyridinyl)methanone, identified by its CAS number 1187164-59-5, is an organic compound characterized by its complex structure, which includes a dichlorophenyl group and a pyridinyl moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of functional groups. The dichlorophenyl group contributes to its lipophilicity and may influence its biological activity, while the pyridinyl component can participate in coordination chemistry and hydrogen bonding. The presence of chlorine atoms can enhance the compound's electron-withdrawing characteristics, potentially affecting its reactivity and interaction with biological targets. This compound may be of interest in pharmaceutical research and development, particularly in the context of drug design, due to its structural features that could interact with various biological pathways. Overall, its unique combination of functional groups suggests potential applications in medicinal chemistry and materials science.
Formula:C13H9Cl2NO
InChI:InChI=1S/C13H9Cl2NO/c1-8-3-2-6-16-12(8)13(17)9-4-5-10(14)11(15)7-9/h2-7H,1H3
InChI key:InChIKey=HFTWJLDLMAYNPA-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(Cl)=C(Cl)C=C1)C2=C(C)C=CC=N2
Synonyms:
  • Methanone, (3,4-dichlorophenyl)(3-methyl-2-pyridinyl)-
  • (3,4-Dichlorophenyl)(3-methyl-2-pyridinyl)methanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.