CAS 1187164-64-2
:(2,5-Dimethoxyphenyl)(3-methyl-2-pyridinyl)methanone
Description:
(2,5-Dimethoxyphenyl)(3-methyl-2-pyridinyl)methanone, identified by its CAS number 1187164-64-2, is a chemical compound characterized by its complex structure, which includes a phenyl ring substituted with two methoxy groups and a pyridine moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity due to the presence of the pyridine nitrogen. The methoxy groups can influence the compound's solubility and reactivity, often enhancing its lipophilicity. As a ketone, it features a carbonyl group that can participate in various chemical reactions, such as nucleophilic additions. The presence of both aromatic and heteroaromatic systems suggests that this compound may exhibit interesting electronic properties, potentially making it a candidate for applications in pharmaceuticals or organic synthesis. However, specific data regarding its physical properties, such as melting point, boiling point, and spectral characteristics, would require experimental determination or detailed literature references.
Formula:C15H15NO3
InChI:InChI=1S/C15H15NO3/c1-10-5-4-8-16-14(10)15(17)12-9-11(18-2)6-7-13(12)19-3/h4-9H,1-3H3
InChI key:InChIKey=XXXGADXEAKTYHH-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(OC)C=CC(OC)=C1)C2=C(C)C=CC=N2
Synonyms:- Methanone, (2,5-dimethoxyphenyl)(3-methyl-2-pyridinyl)-
- (2,5-Dimethoxyphenyl)(3-methyl-2-pyridinyl)methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.