CAS 1187164-65-3

(3,5-Difluorophenyl)(6-methyl-2-pyridinyl)methanone

Description:

(3,5-Difluorophenyl)(6-methyl-2-pyridinyl)methanone is an organic compound characterized by its complex structure, which includes a phenyl ring substituted with two fluorine atoms at the 3 and 5 positions, and a pyridine ring with a methyl group at the 6 position. This compound features a ketone functional group, which contributes to its reactivity and potential applications in various chemical reactions. The presence of fluorine atoms typically enhances the compound's lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry. The pyridine moiety may also impart unique electronic properties, affecting the compound's interaction with biological targets. Overall, this substance is likely to exhibit interesting chemical behavior due to its diverse functional groups and substituents, making it a candidate for further research in fields such as pharmaceuticals or agrochemicals. Its specific properties, such as solubility, melting point, and reactivity, would need to be determined through experimental studies.

Formula: C₁₃H₉F₂NO

InChI: InChI=1S/C13H9F2NO/c1-8-3-2-4-12(16-8)13(17)9-5-10(14)7-11(15)6-9/h2-7H,1H3

InChI key: InChIKey=WAXUVYVQJPYZNE-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(F)=CC(F)=C1)C=2N=C(C)C=CC2

Synonyms:

• (3,5-Difluorophenyl)(6-methyl-2-pyridinyl)methanone
• Methanone, (3,5-difluorophenyl)(6-methyl-2-pyridinyl)-